About disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride
disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride (PubChem CID 173060250) has the molecular formula C16H15N3Na2O
and a molecular weight of 311.30 g/mol. Its IUPAC name is disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride.
Molecular Properties
| Compound Name | disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride |
| PubChem CID | 173060250 |
| Molecular Formula | C16H15N3Na2O |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride |
| SMILES | Nc1cccc2ccc(/N=N/c3ccccc3)c(O)c12.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C16H13N3O.2Na.2H/c17-13-8-4-5-11-9-10-14(16(20)15(11)13)19-18-12-6-2-1-3-7-12;;;;/h1-10,20H,17H2;;;;/q;2*+1;2*-1/b19-18+;;;; |
| InChIKey | VIRTURHDUMEECV-UJWNJGKXSA-N |
| XLogP | -1.22 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride?
The IUPAC name of disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride (CID 173060250) is disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride.
What is the SMILES notation for disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride?
The canonical SMILES for disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride is Nc1cccc2ccc(/N=N/c3ccccc3)c(O)c12.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride?
The InChIKey is VIRTURHDUMEECV-UJWNJGKXSA-N. The full InChI is InChI=1S/C16H13N3O.2Na.2H/c17-13-8-4-5-11-9-10-14(16(20)15(11)13)19-18-12-6-2-1-3-7-12;;;;/h1-10,20H,17H2;;;;/q;2*+1;2*-1/b19-18+;;;;.
What are the key properties of disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride?
disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride has a molecular weight of 311.30 g/mol, XLogP of -1.22, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;8-amino-2-phenyldiazenylnaphthalen-1-ol;hydride is sourced from PubChem (CID 173060250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).