C25H29ClN2O4 — CID 173061242
1-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperazine;hydron;(Z)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 173061242) has the molecular formula C25H29ClN2O4 and a molecular weight of 456.97 g/mol. Its IUPAC name is 1-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperazine;hydron;(Z)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | 1-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperazine;hydron;(Z)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 173061242 |
| Molecular Formula | C25H29ClN2O4 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 1-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperazine;hydron;(Z)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | CC1(C)CN([C@@H]2C[C@@H](c3ccccc3)c3ccc(Cl)cc32)CCN1.O=C([O-])/C=C\C(=O)O.[H+] |
| InChI | InChI=1S/C21H25ClN2.C4H4O4/c1-21(2)14-24(11-10-23-21)20-13-18(15-6-4-3-5-7-15)17-9-8-16(22)12-19(17)20;5-3(6)1-2-4(7)8/h3-9,12,18,20,23H,10-11,13-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t18-,20+;/m0./s1 |
| InChIKey | RGYMMPPIVUORNP-AMCWWWTGSA-N |
| XLogP | 3.09 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|