C22H22O2Si — CID 173061704
bicyclo[2.2.2]octa-1,3,5,7-tetraene;ethyl(diphenoxy)silane (PubChem CID 173061704) has the molecular formula C22H22O2Si and a molecular weight of 346.50 g/mol. Its IUPAC name is bicyclo[2.2.2]octa-1,3,5,7-tetraene;ethyl(diphenoxy)silane.
| Compound Name | bicyclo[2.2.2]octa-1,3,5,7-tetraene;ethyl(diphenoxy)silane |
|---|---|
| PubChem CID | 173061704 |
| Molecular Formula | C22H22O2Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | bicyclo[2.2.2]octa-1,3,5,7-tetraene;ethyl(diphenoxy)silane |
| SMILES | CC[SiH](Oc1ccccc1)Oc1ccccc1.c1cc2ccc1cc2 |
| InChI | InChI=1S/C14H16O2Si.C8H6/c1-2-17(15-13-9-5-3-6-10-13)16-14-11-7-4-8-12-14;1-2-8-5-3-7(1)4-6-8/h3-12,17H,2H2,1H3;1-6H |
| InChIKey | RIOXMFANFBPTGN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|