About cyclohexylcyclohexane;dihydroxysilane
cyclohexylcyclohexane;dihydroxysilane (PubChem CID 173062511) has the molecular formula C12H26O2Si
and a molecular weight of 230.42 g/mol. Its IUPAC name is cyclohexylcyclohexane;dihydroxysilane.
Molecular Properties
| Compound Name | cyclohexylcyclohexane;dihydroxysilane |
| PubChem CID | 173062511 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | cyclohexylcyclohexane;dihydroxysilane |
| SMILES | C1CCC(C2CCCCC2)CC1.O[SiH2]O |
| InChI | InChI=1S/C12H22.H4O2Si/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h11-12H,1-10H2;1-2H,3H2 |
| InChIKey | RUNSASNEPBWZJD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylcyclohexane;dihydroxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylcyclohexane;dihydroxysilane?
The IUPAC name of cyclohexylcyclohexane;dihydroxysilane (CID 173062511) is cyclohexylcyclohexane;dihydroxysilane.
What is the SMILES notation for cyclohexylcyclohexane;dihydroxysilane?
The canonical SMILES for cyclohexylcyclohexane;dihydroxysilane is C1CCC(C2CCCCC2)CC1.O[SiH2]O.
What is the InChIKey of cyclohexylcyclohexane;dihydroxysilane?
The InChIKey is RUNSASNEPBWZJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22.H4O2Si/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h11-12H,1-10H2;1-2H,3H2.
What are the key properties of cyclohexylcyclohexane;dihydroxysilane?
cyclohexylcyclohexane;dihydroxysilane has a molecular weight of 230.42 g/mol, XLogP of 2.12, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylcyclohexane;dihydroxysilane is sourced from PubChem (CID 173062511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).