C8H8N2O2 — CID 173062786
2,3,4,7-tetrahydrophthalazine-1,8-dione (PubChem CID 173062786) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 2,3,4,7-tetrahydrophthalazine-1,8-dione.
| Compound Name | 2,3,4,7-tetrahydrophthalazine-1,8-dione |
|---|---|
| PubChem CID | 173062786 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 2,3,4,7-tetrahydrophthalazine-1,8-dione |
| SMILES | O=C1CC=CC2=C1C(=O)NNC2 |
| InChI | InChI=1S/C8H8N2O2/c11-6-3-1-2-5-4-9-10-8(12)7(5)6/h1-2,9H,3-4H2,(H,10,12) |
| InChIKey | NGYNKSSVMNWURQ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|