About [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid
[4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid (PubChem CID 173062938) has the molecular formula C24H29N3O8S5
and a molecular weight of 647.84 g/mol. Its IUPAC name is [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid.
Molecular Properties
| Compound Name | [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid |
| PubChem CID | 173062938 |
| Molecular Formula | C24H29N3O8S5 |
| Molecular Weight | 647.84 g/mol |
| Exact Mass | 647.06 |
| IUPAC Name | [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid |
| SMILES | CC(CCC(=O)OC(=O)CCC(=NS(=O)(=O)O)OC(=O)CCC(C)SSc1ccccn1)SSc1ccccn1 |
| InChI | InChI=1S/C24H29N3O8S5/c1-17(36-38-20-7-3-5-15-25-20)9-12-22(28)34-19(27-40(31,32)33)11-14-24(30)35-23(29)13-10-18(2)37-39-21-8-4-6-16-26-21/h3-8,15-18H,9-14H2,1-2H3,(H,31,32,33) |
| InChIKey | DWTFRTOQFAHVQG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 162.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 647.84 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid?
The IUPAC name of [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid (CID 173062938) is [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid.
What is the SMILES notation for [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid?
The canonical SMILES for [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid is CC(CCC(=O)OC(=O)CCC(=NS(=O)(=O)O)OC(=O)CCC(C)SSc1ccccn1)SSc1ccccn1.
What is the InChIKey of [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid?
The InChIKey is DWTFRTOQFAHVQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O8S5/c1-17(36-38-20-7-3-5-15-25-20)9-12-22(28)34-19(27-40(31,32)33)11-14-24(30)35-23(29)13-10-18(2)37-39-21-8-4-6-16-26-21/h3-8,15-18H,9-14H2,1-2H3,(H,31,32,33).
What are the key properties of [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid?
[4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid has a molecular weight of 647.84 g/mol, XLogP of 5.59, 16 rotatable bonds, 1 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for [4-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butylidene]sulfamic acid is sourced from PubChem (CID 173062938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).