About 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine
4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine (PubChem CID 173064044) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine |
| PubChem CID | 173064044 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(CCC2C=CCCC2)CC(C)O1 |
| InChI | InChI=1S/C14H25NO/c1-12-10-15(11-13(2)16-12)9-8-14-6-4-3-5-7-14/h4,6,12-14H,3,5,7-11H2,1-2H3 |
| InChIKey | IZVYKPCOZHQHTC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine?
The IUPAC name of 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine (CID 173064044) is 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine.
What is the SMILES notation for 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine?
The canonical SMILES for 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine is CC1CN(CCC2C=CCCC2)CC(C)O1.
What is the InChIKey of 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine?
The InChIKey is IZVYKPCOZHQHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO/c1-12-10-15(11-13(2)16-12)9-8-14-6-4-3-5-7-14/h4,6,12-14H,3,5,7-11H2,1-2H3.
What are the key properties of 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine?
4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine has a molecular weight of 223.36 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyclohex-2-en-1-ylethyl)-2,6-dimethylmorpholine is sourced from PubChem (CID 173064044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).