About calcium;hydride;3-methoxydioxiran-3-ol
calcium;hydride;3-methoxydioxiran-3-ol (PubChem CID 173064085) has the molecular formula C2H6CaO4
and a molecular weight of 134.14 g/mol. Its IUPAC name is calcium;hydride;3-methoxydioxiran-3-ol.
Molecular Properties
| Compound Name | calcium;hydride;3-methoxydioxiran-3-ol |
| PubChem CID | 173064085 |
| Molecular Formula | C2H6CaO4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 133.99 |
| IUPAC Name | calcium;hydride;3-methoxydioxiran-3-ol |
| SMILES | COC1(O)OO1.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C2H4O4.Ca.2H/c1-4-2(3)5-6-2;;;/h3H,1H3;;;/q;+2;2*-1 |
| InChIKey | OVMCJCAOIHDNIU-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;3-methoxydioxiran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;3-methoxydioxiran-3-ol?
The IUPAC name of calcium;hydride;3-methoxydioxiran-3-ol (CID 173064085) is calcium;hydride;3-methoxydioxiran-3-ol.
What is the SMILES notation for calcium;hydride;3-methoxydioxiran-3-ol?
The canonical SMILES for calcium;hydride;3-methoxydioxiran-3-ol is COC1(O)OO1.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;3-methoxydioxiran-3-ol?
The InChIKey is OVMCJCAOIHDNIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O4.Ca.2H/c1-4-2(3)5-6-2;;;/h3H,1H3;;;/q;+2;2*-1.
What are the key properties of calcium;hydride;3-methoxydioxiran-3-ol?
calcium;hydride;3-methoxydioxiran-3-ol has a molecular weight of 134.14 g/mol, XLogP of -0.96, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;3-methoxydioxiran-3-ol is sourced from PubChem (CID 173064085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).