C30H52 — CID 173064160
(1E,3S,6S,9R)-3,9-dimethyl-6-propan-2-ylcyclodecene;(1R,2R,4S)-1-ethenyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane (PubChem CID 173064160) has the molecular formula C30H52 and a molecular weight of 412.75 g/mol. Its IUPAC name is (1E,3S,6S,9R)-3,9-dimethyl-6-propan-2-ylcyclodecene;(1R,2R,4S)-1-ethenyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane.
| Compound Name | (1E,3S,6S,9R)-3,9-dimethyl-6-propan-2-ylcyclodecene;(1R,2R,4S)-1-ethenyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane |
|---|---|
| PubChem CID | 173064160 |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.41 |
| IUPAC Name | (1E,3S,6S,9R)-3,9-dimethyl-6-propan-2-ylcyclodecene;(1R,2R,4S)-1-ethenyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane |
| SMILES | C=C[C@@]1(C)CC[C@H](C(=C)C)C[C@@H]1C(=C)C.CC(C)[C@H]1CC[C@@H](C)C/C=C/[C@@H](C)CC1 |
| InChI | InChI=1S/C15H24.C15H28/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5;1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h7,13-14H,1-2,4,8-10H2,3,5-6H3;5-6,12-15H,7-11H2,1-4H3/b;6-5+/t2*13-,14+,15-/m01/s1 |
| InChIKey | ZTYHVNQBIYHZMO-QNMZKELTSA-N |
| XLogP | 9.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|