About N,N-diethylethanamine;hydron;bromide;hydrobromide
N,N-diethylethanamine;hydron;bromide;hydrobromide (PubChem CID 173064207) has the molecular formula C6H17Br2N
and a molecular weight of 263.02 g/mol. Its IUPAC name is N,N-diethylethanamine;hydron;bromide;hydrobromide.
Molecular Properties
| Compound Name | N,N-diethylethanamine;hydron;bromide;hydrobromide |
| PubChem CID | 173064207 |
| Molecular Formula | C6H17Br2N |
| Molecular Weight | 263.02 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | N,N-diethylethanamine;hydron;bromide;hydrobromide |
| SMILES | Br.CCN(CC)CC.[Br-].[H+] |
| InChI | InChI=1S/C6H15N.2BrH/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;2*1H |
| InChIKey | JMUOCDDDFRLJRM-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.02 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethylethanamine;hydron;bromide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;hydron;bromide;hydrobromide?
The IUPAC name of N,N-diethylethanamine;hydron;bromide;hydrobromide (CID 173064207) is N,N-diethylethanamine;hydron;bromide;hydrobromide.
What is the SMILES notation for N,N-diethylethanamine;hydron;bromide;hydrobromide?
The canonical SMILES for N,N-diethylethanamine;hydron;bromide;hydrobromide is Br.CCN(CC)CC.[Br-].[H+].
What is the InChIKey of N,N-diethylethanamine;hydron;bromide;hydrobromide?
The InChIKey is JMUOCDDDFRLJRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.2BrH/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;2*1H.
What are the key properties of N,N-diethylethanamine;hydron;bromide;hydrobromide?
N,N-diethylethanamine;hydron;bromide;hydrobromide has a molecular weight of 263.02 g/mol, XLogP of -0.96, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;hydron;bromide;hydrobromide is sourced from PubChem (CID 173064207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).