About 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide
3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide (PubChem CID 173064426) has the molecular formula C20H26N2O2Si
and a molecular weight of 354.53 g/mol. Its IUPAC name is 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide |
| PubChem CID | 173064426 |
| Molecular Formula | C20H26N2O2Si |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide |
| SMILES | CCCC[Si](C)(C)c1ccc(-c2ccccc2)c(C(N)=O)c1C(N)=O |
| InChI | InChI=1S/C20H26N2O2Si/c1-4-5-13-25(2,3)16-12-11-15(14-9-7-6-8-10-14)17(19(21)23)18(16)20(22)24/h6-12H,4-5,13H2,1-3H3,(H2,21,23)(H2,22,24) |
| InChIKey | KDRKNKBPQWCSPT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide?
The IUPAC name of 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide (CID 173064426) is 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide.
What is the SMILES notation for 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide?
The canonical SMILES for 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide is CCCC[Si](C)(C)c1ccc(-c2ccccc2)c(C(N)=O)c1C(N)=O.
What is the InChIKey of 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide?
The InChIKey is KDRKNKBPQWCSPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O2Si/c1-4-5-13-25(2,3)16-12-11-15(14-9-7-6-8-10-14)17(19(21)23)18(16)20(22)24/h6-12H,4-5,13H2,1-3H3,(H2,21,23)(H2,22,24).
What are the key properties of 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide?
3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide has a molecular weight of 354.53 g/mol, XLogP of 3.27, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[butyl(dimethyl)silyl]-6-phenylbenzene-1,2-dicarboxamide is sourced from PubChem (CID 173064426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).