C12H25AlO12 — CID 173064476
alumane;(2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroperoxymethyl)oxane-3,4,5-triol (PubChem CID 173064476) has the molecular formula C12H25AlO12 and a molecular weight of 388.30 g/mol. Its IUPAC name is alumane;(2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroperoxymethyl)oxane-3,4,5-triol.
| Compound Name | alumane;(2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroperoxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 173064476 |
| Molecular Formula | C12H25AlO12 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | alumane;(2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroperoxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](COO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O.[AlH3] |
| InChI | InChI=1S/C12H22O12.Al.3H/c13-1-4-7(16)10(19)12(3-14,23-4)24-11-9(18)8(17)6(15)5(22-11)2-21-20;;;;/h4-11,13-20H,1-3H2;;;;/t4-,5-,6-,7-,8+,9-,10+,11-,12+;;;;/m1..../s1 |
| InChIKey | ITVOBWZZKPXOHW-QYGVOOBQSA-N |
| XLogP | -6.08 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | -6.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|