C18H30O5 — CID 173064483
3-(ethoxymethyl)-1,5,6,6-tetramethoxy-5-(3-methylbut-2-enyl)cyclohexa-1,3-diene (PubChem CID 173064483) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is 3-(ethoxymethyl)-1,5,6,6-tetramethoxy-5-(3-methylbut-2-enyl)cyclohexa-1,3-diene.
| Compound Name | 3-(ethoxymethyl)-1,5,6,6-tetramethoxy-5-(3-methylbut-2-enyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 173064483 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 3-(ethoxymethyl)-1,5,6,6-tetramethoxy-5-(3-methylbut-2-enyl)cyclohexa-1,3-diene |
| SMILES | CCOCC1=CC(CC=C(C)C)(OC)C(OC)(OC)C(OC)=C1 |
| InChI | InChI=1S/C18H30O5/c1-8-23-13-15-11-16(19-4)18(21-6,22-7)17(12-15,20-5)10-9-14(2)3/h9,11-12H,8,10,13H2,1-7H3 |
| InChIKey | RRNDHUHPKOJLEK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|