About 2-tert-butylsilyl-N,N-dimethylpropan-1-amine
2-tert-butylsilyl-N,N-dimethylpropan-1-amine (PubChem CID 173064610) has the molecular formula C9H23NSi
and a molecular weight of 173.38 g/mol. Its IUPAC name is 2-tert-butylsilyl-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 2-tert-butylsilyl-N,N-dimethylpropan-1-amine |
| PubChem CID | 173064610 |
| Molecular Formula | C9H23NSi |
| Molecular Weight | 173.38 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | 2-tert-butylsilyl-N,N-dimethylpropan-1-amine |
| SMILES | CC(CN(C)C)[SiH2]C(C)(C)C |
| InChI | InChI=1S/C9H23NSi/c1-8(7-10(5)6)11-9(2,3)4/h8H,7,11H2,1-6H3 |
| InChIKey | DJRBJIIEJNDWMW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylsilyl-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylsilyl-N,N-dimethylpropan-1-amine?
The IUPAC name of 2-tert-butylsilyl-N,N-dimethylpropan-1-amine (CID 173064610) is 2-tert-butylsilyl-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 2-tert-butylsilyl-N,N-dimethylpropan-1-amine?
The canonical SMILES for 2-tert-butylsilyl-N,N-dimethylpropan-1-amine is CC(CN(C)C)[SiH2]C(C)(C)C.
What is the InChIKey of 2-tert-butylsilyl-N,N-dimethylpropan-1-amine?
The InChIKey is DJRBJIIEJNDWMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23NSi/c1-8(7-10(5)6)11-9(2,3)4/h8H,7,11H2,1-6H3.
What are the key properties of 2-tert-butylsilyl-N,N-dimethylpropan-1-amine?
2-tert-butylsilyl-N,N-dimethylpropan-1-amine has a molecular weight of 173.38 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylsilyl-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 173064610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).