C13H31NSi — CID 173064954
3-tert-butyl-N,N,4,4-tetramethyl-3-silylpentan-2-amine (PubChem CID 173064954) has the molecular formula C13H31NSi and a molecular weight of 229.48 g/mol. Its IUPAC name is 3-tert-butyl-N,N,4,4-tetramethyl-3-silylpentan-2-amine.
| Compound Name | 3-tert-butyl-N,N,4,4-tetramethyl-3-silylpentan-2-amine |
|---|---|
| PubChem CID | 173064954 |
| Molecular Formula | C13H31NSi |
| Molecular Weight | 229.48 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 3-tert-butyl-N,N,4,4-tetramethyl-3-silylpentan-2-amine |
| SMILES | CC(N(C)C)C([SiH3])(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H31NSi/c1-10(14(8)9)13(15,11(2,3)4)12(5,6)7/h10H,1-9,15H3 |
| InChIKey | MAJULYQKFHRSMN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|