C12H29NSi — CID 173065140
2-tert-butyl-N,N,3,3-tetramethyl-2-silylbutan-1-amine (PubChem CID 173065140) has the molecular formula C12H29NSi and a molecular weight of 215.46 g/mol. Its IUPAC name is 2-tert-butyl-N,N,3,3-tetramethyl-2-silylbutan-1-amine.
| Compound Name | 2-tert-butyl-N,N,3,3-tetramethyl-2-silylbutan-1-amine |
|---|---|
| PubChem CID | 173065140 |
| Molecular Formula | C12H29NSi |
| Molecular Weight | 215.46 g/mol |
| Exact Mass | 215.21 |
| IUPAC Name | 2-tert-butyl-N,N,3,3-tetramethyl-2-silylbutan-1-amine |
| SMILES | CN(C)CC([SiH3])(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H29NSi/c1-10(2,3)12(14,9-13(7)8)11(4,5)6/h9H2,1-8,14H3 |
| InChIKey | RSXQDGBVQIMNQH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|