C24H25F3N2O3 — CID 173066215
4-[[7-methyl-1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-5-yl]methyl]piperidine-1-carbaldehyde (PubChem CID 173066215) has the molecular formula C24H25F3N2O3 and a molecular weight of 446.47 g/mol. Its IUPAC name is 4-[[7-methyl-1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-5-yl]methyl]piperidine-1-carbaldehyde.
| Compound Name | 4-[[7-methyl-1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-5-yl]methyl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 173066215 |
| Molecular Formula | C24H25F3N2O3 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 4-[[7-methyl-1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-5-yl]methyl]piperidine-1-carbaldehyde |
| SMILES | Cc1cc(CC2CCN(C=O)CC2)cc2c1C(=O)N(Cc1ccc(OC(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C24H25F3N2O3/c1-16-10-19(11-17-6-8-28(15-30)9-7-17)12-20-14-29(23(31)22(16)20)13-18-2-4-21(5-3-18)32-24(25,26)27/h2-5,10,12,15,17H,6-9,11,13-14H2,1H3 |
| InChIKey | VXXSWOHGBDXUJI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|