About 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+)
2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+) (PubChem CID 173066298) has the molecular formula C13H21Ru
and a molecular weight of 278.38 g/mol. Its IUPAC name is 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+).
Molecular Properties
| Compound Name | 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+) |
| PubChem CID | 173066298 |
| Molecular Formula | C13H21Ru |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+) |
| SMILES | CC(C)CC1=[C-]CC=C1CC(C)C.[Ru+] |
| InChI | InChI=1S/C13H21.Ru/c1-10(2)8-12-6-5-7-13(12)9-11(3)4;/h6,10-11H,5,8-9H2,1-4H3;/q-1;+1 |
| InChIKey | PSVDSKAGRKFOSN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+)?
The IUPAC name of 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+) (CID 173066298) is 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+).
What is the SMILES notation for 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+)?
The canonical SMILES for 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+) is CC(C)CC1=[C-]CC=C1CC(C)C.[Ru+].
What is the InChIKey of 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+)?
The InChIKey is PSVDSKAGRKFOSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21.Ru/c1-10(2)8-12-6-5-7-13(12)9-11(3)4;/h6,10-11H,5,8-9H2,1-4H3;/q-1;+1.
What are the key properties of 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+)?
2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+) has a molecular weight of 278.38 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(2-methylpropyl)cyclopenta-1,3-diene;ruthenium(1+) is sourced from PubChem (CID 173066298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).