About 1H-imidazole;3-methylpentan-2-ol;hydrochloride
1H-imidazole;3-methylpentan-2-ol;hydrochloride (PubChem CID 173066373) has the molecular formula C9H19ClN2O
and a molecular weight of 206.72 g/mol. Its IUPAC name is 1H-imidazole;3-methylpentan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 1H-imidazole;3-methylpentan-2-ol;hydrochloride |
| PubChem CID | 173066373 |
| Molecular Formula | C9H19ClN2O |
| Molecular Weight | 206.72 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 1H-imidazole;3-methylpentan-2-ol;hydrochloride |
| SMILES | CCC(C)C(C)O.Cl.c1c[nH]cn1 |
| InChI | InChI=1S/C6H14O.C3H4N2.ClH/c1-4-5(2)6(3)7;1-2-5-3-4-1;/h5-7H,4H2,1-3H3;1-3H,(H,4,5);1H |
| InChIKey | NYUNFDXCCUPCAQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.72 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-imidazole;3-methylpentan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;3-methylpentan-2-ol;hydrochloride?
The IUPAC name of 1H-imidazole;3-methylpentan-2-ol;hydrochloride (CID 173066373) is 1H-imidazole;3-methylpentan-2-ol;hydrochloride.
What is the SMILES notation for 1H-imidazole;3-methylpentan-2-ol;hydrochloride?
The canonical SMILES for 1H-imidazole;3-methylpentan-2-ol;hydrochloride is CCC(C)C(C)O.Cl.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;3-methylpentan-2-ol;hydrochloride?
The InChIKey is NYUNFDXCCUPCAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C3H4N2.ClH/c1-4-5(2)6(3)7;1-2-5-3-4-1;/h5-7H,4H2,1-3H3;1-3H,(H,4,5);1H.
What are the key properties of 1H-imidazole;3-methylpentan-2-ol;hydrochloride?
1H-imidazole;3-methylpentan-2-ol;hydrochloride has a molecular weight of 206.72 g/mol, XLogP of 2.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;3-methylpentan-2-ol;hydrochloride is sourced from PubChem (CID 173066373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).