About [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane
[9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane (PubChem CID 173066954) has the molecular formula C16H32OSi
and a molecular weight of 268.52 g/mol. Its IUPAC name is [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane |
| PubChem CID | 173066954 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane |
| SMILES | C[SiH](C)OC(CCCCCCC1=CC1)C(C)(C)C |
| InChI | InChI=1S/C16H32OSi/c1-16(2,3)15(17-18(4)5)11-9-7-6-8-10-14-12-13-14/h12,15,18H,6-11,13H2,1-5H3 |
| InChIKey | LFLMYHSCQFEGFY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane?
The IUPAC name of [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane (CID 173066954) is [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane.
What is the SMILES notation for [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane?
The canonical SMILES for [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane is C[SiH](C)OC(CCCCCCC1=CC1)C(C)(C)C.
What is the InChIKey of [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane?
The InChIKey is LFLMYHSCQFEGFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32OSi/c1-16(2,3)15(17-18(4)5)11-9-7-6-8-10-14-12-13-14/h12,15,18H,6-11,13H2,1-5H3.
What are the key properties of [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane?
[9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane has a molecular weight of 268.52 g/mol, XLogP of 5.07, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [9-(cyclopropen-1-yl)-2,2-dimethylnonan-3-yl]oxy-dimethylsilane is sourced from PubChem (CID 173066954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).