About 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate
1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate (PubChem CID 173066966) has the molecular formula C7H12O4Si
and a molecular weight of 188.25 g/mol. Its IUPAC name is 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate.
Molecular Properties
| Compound Name | 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate |
| PubChem CID | 173066966 |
| Molecular Formula | C7H12O4Si |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate |
| SMILES | COC(=O)/C(C)=C(/C)C(=O)O[SiH3] |
| InChI | InChI=1S/C7H12O4Si/c1-4(6(8)10-3)5(2)7(9)11-12/h1-3,12H3/b5-4- |
| InChIKey | WAMDCEJVSZUNBE-PLNGDYQASA-N |
| XLogP | -0.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate?
The IUPAC name of 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate (CID 173066966) is 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate.
What is the SMILES notation for 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate?
The canonical SMILES for 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate is COC(=O)/C(C)=C(/C)C(=O)O[SiH3].
What is the InChIKey of 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate?
The InChIKey is WAMDCEJVSZUNBE-PLNGDYQASA-N. The full InChI is InChI=1S/C7H12O4Si/c1-4(6(8)10-3)5(2)7(9)11-12/h1-3,12H3/b5-4-.
What are the key properties of 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate?
1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate has a molecular weight of 188.25 g/mol, XLogP of -0.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 4-O-silyl (Z)-2,3-dimethylbut-2-enedioate is sourced from PubChem (CID 173066966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).