About 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene
6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene (PubChem CID 173067766) has the molecular formula C13H18F2O
and a molecular weight of 228.28 g/mol. Its IUPAC name is 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene |
| PubChem CID | 173067766 |
| Molecular Formula | C13H18F2O |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene |
| SMILES | FC1=CC(F)(OCC2CCCCC2)CC=C1 |
| InChI | InChI=1S/C13H18F2O/c14-12-7-4-8-13(15,9-12)16-10-11-5-2-1-3-6-11/h4,7,9,11H,1-3,5-6,8,10H2 |
| InChIKey | LZDAMYWQHYGHOT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene?
The IUPAC name of 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene (CID 173067766) is 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene.
What is the SMILES notation for 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene?
The canonical SMILES for 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene is FC1=CC(F)(OCC2CCCCC2)CC=C1.
What is the InChIKey of 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene?
The InChIKey is LZDAMYWQHYGHOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2O/c14-12-7-4-8-13(15,9-12)16-10-11-5-2-1-3-6-11/h4,7,9,11H,1-3,5-6,8,10H2.
What are the key properties of 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene?
6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene has a molecular weight of 228.28 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(cyclohexylmethoxy)-2,6-difluorocyclohexa-1,3-diene is sourced from PubChem (CID 173067766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).