About alumane;silicic acid
alumane;silicic acid (PubChem CID 173068853) has the molecular formula H11AlO8Si2
and a molecular weight of 222.23 g/mol. Its IUPAC name is alumane;silicic acid.
Molecular Properties
| Compound Name | alumane;silicic acid |
| PubChem CID | 173068853 |
| Molecular Formula | H11AlO8Si2 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | alumane;silicic acid |
| SMILES | O[Si](O)(O)O.O[Si](O)(O)O.[AlH3] |
| InChI | InChI=1S/Al.2H4O4Si.3H/c;2*1-5(2,3)4;;;/h;2*1-4H;;; |
| InChIKey | GAXMSXYWWVEHPT-UHFFFAOYSA-N |
| XLogP | -6.40 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | -6.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze alumane;silicic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;silicic acid?
The IUPAC name of alumane;silicic acid (CID 173068853) is alumane;silicic acid.
What is the SMILES notation for alumane;silicic acid?
The canonical SMILES for alumane;silicic acid is O[Si](O)(O)O.O[Si](O)(O)O.[AlH3].
What is the InChIKey of alumane;silicic acid?
The InChIKey is GAXMSXYWWVEHPT-UHFFFAOYSA-N. The full InChI is InChI=1S/Al.2H4O4Si.3H/c;2*1-5(2,3)4;;;/h;2*1-4H;;;.
What are the key properties of alumane;silicic acid?
alumane;silicic acid has a molecular weight of 222.23 g/mol, XLogP of -6.40, 0 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;silicic acid is sourced from PubChem (CID 173068853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).