C21H26N4O5S — CID 173069255
[4-carbamoyl-2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] N-tert-butyl-N-piperidin-3-ylcarbamate (PubChem CID 173069255) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is [4-carbamoyl-2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] N-tert-butyl-N-piperidin-3-ylcarbamate.
| Compound Name | [4-carbamoyl-2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] N-tert-butyl-N-piperidin-3-ylcarbamate |
|---|---|
| PubChem CID | 173069255 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | [4-carbamoyl-2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] N-tert-butyl-N-piperidin-3-ylcarbamate |
| SMILES | CC(C)(C)N(C(=O)Oc1ccc(C(N)=O)cc1C=C1SC(=O)NC1=O)C1CCCNC1 |
| InChI | InChI=1S/C21H26N4O5S/c1-21(2,3)25(14-5-4-8-23-11-14)20(29)30-15-7-6-12(17(22)26)9-13(15)10-16-18(27)24-19(28)31-16/h6-7,9-10,14,23H,4-5,8,11H2,1-3H3,(H2,22,26)(H,24,27,28) |
| InChIKey | IHTLNYDXVAHLCH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|