C19H27ClN4O4S — CID 173069375
5-[[2-[(3S)-3-(3-aminopropylamino)pyrrolidin-1-yl]-4,5-dimethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 173069375) has the molecular formula C19H27ClN4O4S and a molecular weight of 442.97 g/mol. Its IUPAC name is 5-[[2-[(3S)-3-(3-aminopropylamino)pyrrolidin-1-yl]-4,5-dimethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 5-[[2-[(3S)-3-(3-aminopropylamino)pyrrolidin-1-yl]-4,5-dimethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 173069375 |
| Molecular Formula | C19H27ClN4O4S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 5-[[2-[(3S)-3-(3-aminopropylamino)pyrrolidin-1-yl]-4,5-dimethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | COc1cc(C=C2SC(=O)NC2=O)c(N2CC[C@H](NCCCN)C2)cc1OC.Cl |
| InChI | InChI=1S/C19H26N4O4S.ClH/c1-26-15-8-12(9-17-18(24)22-19(25)28-17)14(10-16(15)27-2)23-7-4-13(11-23)21-6-3-5-20;/h8-10,13,21H,3-7,11,20H2,1-2H3,(H,22,24,25);1H/t13-;/m0./s1 |
| InChIKey | BWOQSUVULRUMLM-ZOWNYOTGSA-N |
| XLogP | 1.97 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|