C14H15Cl2N3O2S — CID 173069429
5-[[2-[(3S)-3-aminopyrrolidin-1-yl]-4-chlorophenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 173069429) has the molecular formula C14H15Cl2N3O2S and a molecular weight of 360.27 g/mol. Its IUPAC name is 5-[[2-[(3S)-3-aminopyrrolidin-1-yl]-4-chlorophenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 5-[[2-[(3S)-3-aminopyrrolidin-1-yl]-4-chlorophenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 173069429 |
| Molecular Formula | C14H15Cl2N3O2S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 5-[[2-[(3S)-3-aminopyrrolidin-1-yl]-4-chlorophenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.N[C@H]1CCN(c2cc(Cl)ccc2C=C2SC(=O)NC2=O)C1 |
| InChI | InChI=1S/C14H14ClN3O2S.ClH/c15-9-2-1-8(5-12-13(19)17-14(20)21-12)11(6-9)18-4-3-10(16)7-18;/h1-2,5-6,10H,3-4,7,16H2,(H,17,19,20);1H/t10-;/m0./s1 |
| InChIKey | DTAUNSRLBNWGKO-PPHPATTJSA-N |
| XLogP | 2.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|