C12H15N — CID 173069598
4-(2-cyclopropylcyclopropyl)-2-methylpyridine (PubChem CID 173069598) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-(2-cyclopropylcyclopropyl)-2-methylpyridine.
| Compound Name | 4-(2-cyclopropylcyclopropyl)-2-methylpyridine |
|---|---|
| PubChem CID | 173069598 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 4-(2-cyclopropylcyclopropyl)-2-methylpyridine |
| SMILES | Cc1cc(C2CC2C2CC2)ccn1 |
| InChI | InChI=1S/C12H15N/c1-8-6-10(4-5-13-8)12-7-11(12)9-2-3-9/h4-6,9,11-12H,2-3,7H2,1H3 |
| InChIKey | VQHVUIIIRAPPCB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |