About 2,2,3-triethoxydecanal
2,2,3-triethoxydecanal (PubChem CID 173069697) has the molecular formula C16H32O4
and a molecular weight of 288.43 g/mol. Its IUPAC name is 2,2,3-triethoxydecanal.
Molecular Properties
| Compound Name | 2,2,3-triethoxydecanal |
| PubChem CID | 173069697 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2,2,3-triethoxydecanal |
| SMILES | CCCCCCCC(OCC)C(C=O)(OCC)OCC |
| InChI | InChI=1S/C16H32O4/c1-5-9-10-11-12-13-15(18-6-2)16(14-17,19-7-3)20-8-4/h14-15H,5-13H2,1-4H3 |
| InChIKey | SNAYZMATUIPTFM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2,3-triethoxydecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,3-triethoxydecanal?
The IUPAC name of 2,2,3-triethoxydecanal (CID 173069697) is 2,2,3-triethoxydecanal.
What is the SMILES notation for 2,2,3-triethoxydecanal?
The canonical SMILES for 2,2,3-triethoxydecanal is CCCCCCCC(OCC)C(C=O)(OCC)OCC.
What is the InChIKey of 2,2,3-triethoxydecanal?
The InChIKey is SNAYZMATUIPTFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O4/c1-5-9-10-11-12-13-15(18-6-2)16(14-17,19-7-3)20-8-4/h14-15H,5-13H2,1-4H3.
What are the key properties of 2,2,3-triethoxydecanal?
2,2,3-triethoxydecanal has a molecular weight of 288.43 g/mol, XLogP of 3.72, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3-triethoxydecanal is sourced from PubChem (CID 173069697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).