C14H13Cl2F3N2O4 — CID 173069723
(2,2,2-trifluoroacetyl) 4-(2-aminoethoxyimino)-4-(3,4-dichlorophenyl)butanoate (PubChem CID 173069723) has the molecular formula C14H13Cl2F3N2O4 and a molecular weight of 401.17 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-(2-aminoethoxyimino)-4-(3,4-dichlorophenyl)butanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-(2-aminoethoxyimino)-4-(3,4-dichlorophenyl)butanoate |
|---|---|
| PubChem CID | 173069723 |
| Molecular Formula | C14H13Cl2F3N2O4 |
| Molecular Weight | 401.17 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-(2-aminoethoxyimino)-4-(3,4-dichlorophenyl)butanoate |
| SMILES | NCCON=C(CCC(=O)OC(=O)C(F)(F)F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2F3N2O4/c15-9-2-1-8(7-10(9)16)11(21-24-6-5-20)3-4-12(22)25-13(23)14(17,18)19/h1-2,7H,3-6,20H2 |
| InChIKey | QYENZCZVEOCCOV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.17 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|