C22H25N7O5S3 — CID 173070133
(7R)-3-[[3-(2-aminoethylsulfanylmethyl)-4-pyridinyl]sulfanyl]-7-[[2-(2-amino-5-methyl-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 173070133) has the molecular formula C22H25N7O5S3 and a molecular weight of 563.69 g/mol. Its IUPAC name is (7R)-3-[[3-(2-aminoethylsulfanylmethyl)-4-pyridinyl]sulfanyl]-7-[[2-(2-amino-5-methyl-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (7R)-3-[[3-(2-aminoethylsulfanylmethyl)-4-pyridinyl]sulfanyl]-7-[[2-(2-amino-5-methyl-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 173070133 |
| Molecular Formula | C22H25N7O5S3 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | (7R)-3-[[3-(2-aminoethylsulfanylmethyl)-4-pyridinyl]sulfanyl]-7-[[2-(2-amino-5-methyl-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Cc1sc(N)nc1C(=NO)C(=O)N[C@H]1C(=O)N2C(C(=O)O)=C(Sc3ccncc3CSCCN)CCC12 |
| InChI | InChI=1S/C22H25N7O5S3/c1-10-15(27-22(24)36-10)17(28-34)19(30)26-16-12-2-3-14(18(21(32)33)29(12)20(16)31)37-13-4-6-25-8-11(13)9-35-7-5-23/h4,6,8,12,16,34H,2-3,5,7,9,23H2,1H3,(H2,24,27)(H,26,30)(H,32,33)/t12?,16-/m1/s1 |
| InChIKey | DFPREDVIASEOOM-PVQCJRHBSA-N |
| XLogP | 1.38 |
| TPSA | 197.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|