About methyl hydrogen carbonate;9-octylheptadecan-9-amine
methyl hydrogen carbonate;9-octylheptadecan-9-amine (PubChem CID 173070784) has the molecular formula C27H57NO3
and a molecular weight of 443.76 g/mol. Its IUPAC name is methyl hydrogen carbonate;9-octylheptadecan-9-amine.
Molecular Properties
| Compound Name | methyl hydrogen carbonate;9-octylheptadecan-9-amine |
| PubChem CID | 173070784 |
| Molecular Formula | C27H57NO3 |
| Molecular Weight | 443.76 g/mol |
| Exact Mass | 443.43 |
| IUPAC Name | methyl hydrogen carbonate;9-octylheptadecan-9-amine |
| SMILES | CCCCCCCCC(N)(CCCCCCCC)CCCCCCCC.COC(=O)O |
| InChI | InChI=1S/C25H53N.C2H4O3/c1-4-7-10-13-16-19-22-25(26,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-5-2(3)4/h4-24,26H2,1-3H3;1H3,(H,3,4) |
| InChIKey | QUAGBLIECLZLQJ-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.76 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl hydrogen carbonate;9-octylheptadecan-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl hydrogen carbonate;9-octylheptadecan-9-amine?
The IUPAC name of methyl hydrogen carbonate;9-octylheptadecan-9-amine (CID 173070784) is methyl hydrogen carbonate;9-octylheptadecan-9-amine.
What is the SMILES notation for methyl hydrogen carbonate;9-octylheptadecan-9-amine?
The canonical SMILES for methyl hydrogen carbonate;9-octylheptadecan-9-amine is CCCCCCCCC(N)(CCCCCCCC)CCCCCCCC.COC(=O)O.
What is the InChIKey of methyl hydrogen carbonate;9-octylheptadecan-9-amine?
The InChIKey is QUAGBLIECLZLQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H53N.C2H4O3/c1-4-7-10-13-16-19-22-25(26,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-5-2(3)4/h4-24,26H2,1-3H3;1H3,(H,3,4).
What are the key properties of methyl hydrogen carbonate;9-octylheptadecan-9-amine?
methyl hydrogen carbonate;9-octylheptadecan-9-amine has a molecular weight of 443.76 g/mol, XLogP of 9.25, 21 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl hydrogen carbonate;9-octylheptadecan-9-amine is sourced from PubChem (CID 173070784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).