About 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol
2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol (PubChem CID 173070928) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol |
| PubChem CID | 173070928 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol |
| SMILES | OCCN1CCC(C2=CCCC=C2)CC1 |
| InChI | InChI=1S/C13H21NO/c15-11-10-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h2,4-5,13,15H,1,3,6-11H2 |
| InChIKey | HMZANFBQUZFERB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol?
The IUPAC name of 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol (CID 173070928) is 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol.
What is the SMILES notation for 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol?
The canonical SMILES for 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol is OCCN1CCC(C2=CCCC=C2)CC1.
What is the InChIKey of 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol?
The InChIKey is HMZANFBQUZFERB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c15-11-10-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h2,4-5,13,15H,1,3,6-11H2.
What are the key properties of 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol?
2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol has a molecular weight of 207.32 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclohexa-1,5-dien-1-ylpiperidin-1-yl)ethanol is sourced from PubChem (CID 173070928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).