About (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol
(6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol (PubChem CID 173070962) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol |
| PubChem CID | 173070962 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol |
| SMILES | OCC1=CCCC=C1N1CCNCC1 |
| InChI | InChI=1S/C11H18N2O/c14-9-10-3-1-2-4-11(10)13-7-5-12-6-8-13/h3-4,12,14H,1-2,5-9H2 |
| InChIKey | IIDXXOFYVNZEBP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol?
The IUPAC name of (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol (CID 173070962) is (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol.
What is the SMILES notation for (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol?
The canonical SMILES for (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol is OCC1=CCCC=C1N1CCNCC1.
What is the InChIKey of (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol?
The InChIKey is IIDXXOFYVNZEBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c14-9-10-3-1-2-4-11(10)13-7-5-12-6-8-13/h3-4,12,14H,1-2,5-9H2.
What are the key properties of (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol?
(6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol has a molecular weight of 194.28 g/mol, XLogP of 0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-piperazin-1-ylcyclohexa-1,5-dien-1-yl)methanol is sourced from PubChem (CID 173070962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).