About 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine
3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine (PubChem CID 173071040) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine.
Molecular Properties
| Compound Name | 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine |
| PubChem CID | 173071040 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine |
| SMILES | CC(C)N1CC(OC2=CCCC=C2)C1 |
| InChI | InChI=1S/C12H19NO/c1-10(2)13-8-12(9-13)14-11-6-4-3-5-7-11/h4,6-7,10,12H,3,5,8-9H2,1-2H3 |
| InChIKey | ZERGEONOVHEAJB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine?
The IUPAC name of 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine (CID 173071040) is 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine.
What is the SMILES notation for 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine?
The canonical SMILES for 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine is CC(C)N1CC(OC2=CCCC=C2)C1.
What is the InChIKey of 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine?
The InChIKey is ZERGEONOVHEAJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-10(2)13-8-12(9-13)14-11-6-4-3-5-7-11/h4,6-7,10,12H,3,5,8-9H2,1-2H3.
What are the key properties of 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine?
3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine has a molecular weight of 193.29 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,5-dien-1-yloxy-1-propan-2-ylazetidine is sourced from PubChem (CID 173071040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).