About 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol
1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol (PubChem CID 173071099) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol |
| PubChem CID | 173071099 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol |
| SMILES | CC1=CCCC=C1N1CCC(O)CC1 |
| InChI | InChI=1S/C12H19NO/c1-10-4-2-3-5-12(10)13-8-6-11(14)7-9-13/h4-5,11,14H,2-3,6-9H2,1H3 |
| InChIKey | XSNOZKBXYNKUME-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol?
The IUPAC name of 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol (CID 173071099) is 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol.
What is the SMILES notation for 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol?
The canonical SMILES for 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol is CC1=CCCC=C1N1CCC(O)CC1.
What is the InChIKey of 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol?
The InChIKey is XSNOZKBXYNKUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-10-4-2-3-5-12(10)13-8-6-11(14)7-9-13/h4-5,11,14H,2-3,6-9H2,1H3.
What are the key properties of 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol?
1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol has a molecular weight of 193.29 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methylcyclohexa-1,5-dien-1-yl)piperidin-4-ol is sourced from PubChem (CID 173071099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).