hydrogen sulfite;phosphane

H4O3PS- — CID 173071517

IUPAChydrogen sulfite;phosphane
SMILESO=S([O-])O.P
InChIInChI=1S/H2O3S.H3P/c1-4(2)3;/h(H2,1,2,3);1H3/p-1
InChIKeyBRHPAOMNPCLPNJ-UHFFFAOYSA-M
MW115.07 g/mol
LogP-0.60
Rot. Bonds

About hydrogen sulfite;phosphane

hydrogen sulfite;phosphane (PubChem CID 173071517) has the molecular formula H4O3PS- and a molecular weight of 115.07 g/mol. Its IUPAC name is hydrogen sulfite;phosphane.

Molecular Properties

Compound Namehydrogen sulfite;phosphane
PubChem CID173071517
Molecular FormulaH4O3PS-
Molecular Weight115.07 g/mol
Exact Mass114.96
IUPAC Namehydrogen sulfite;phosphane
SMILESO=S([O-])O.P
InChIInChI=1S/H2O3S.H3P/c1-4(2)3;/h(H2,1,2,3);1H3/p-1
InChIKeyBRHPAOMNPCLPNJ-UHFFFAOYSA-M
XLogP-0.60
TPSA60.36 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500115.07
LogP ≤ 5-0.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze hydrogen sulfite;phosphane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen sulfite;phosphane?
The IUPAC name of hydrogen sulfite;phosphane (CID 173071517) is hydrogen sulfite;phosphane.
What is the SMILES notation for hydrogen sulfite;phosphane?
The canonical SMILES for hydrogen sulfite;phosphane is O=S([O-])O.P.
What is the InChIKey of hydrogen sulfite;phosphane?
The InChIKey is BRHPAOMNPCLPNJ-UHFFFAOYSA-M. The full InChI is InChI=1S/H2O3S.H3P/c1-4(2)3;/h(H2,1,2,3);1H3/p-1.
What are the key properties of hydrogen sulfite;phosphane?
hydrogen sulfite;phosphane has a molecular weight of 115.07 g/mol, XLogP of -0.60, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;phosphane is sourced from PubChem (CID 173071517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).