About hydrogen sulfite;phosphane
hydrogen sulfite;phosphane (PubChem CID 173071517) has the molecular formula H4O3PS-
and a molecular weight of 115.07 g/mol. Its IUPAC name is hydrogen sulfite;phosphane.
Molecular Properties
| Compound Name | hydrogen sulfite;phosphane |
| PubChem CID | 173071517 |
| Molecular Formula | H4O3PS- |
| Molecular Weight | 115.07 g/mol |
| Exact Mass | 114.96 |
| IUPAC Name | hydrogen sulfite;phosphane |
| SMILES | O=S([O-])O.P |
| InChI | InChI=1S/H2O3S.H3P/c1-4(2)3;/h(H2,1,2,3);1H3/p-1 |
| InChIKey | BRHPAOMNPCLPNJ-UHFFFAOYSA-M |
| XLogP | -0.60 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.07 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze hydrogen sulfite;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen sulfite;phosphane?
The IUPAC name of hydrogen sulfite;phosphane (CID 173071517) is hydrogen sulfite;phosphane.
What is the SMILES notation for hydrogen sulfite;phosphane?
The canonical SMILES for hydrogen sulfite;phosphane is O=S([O-])O.P.
What is the InChIKey of hydrogen sulfite;phosphane?
The InChIKey is BRHPAOMNPCLPNJ-UHFFFAOYSA-M. The full InChI is InChI=1S/H2O3S.H3P/c1-4(2)3;/h(H2,1,2,3);1H3/p-1.
What are the key properties of hydrogen sulfite;phosphane?
hydrogen sulfite;phosphane has a molecular weight of 115.07 g/mol, XLogP of -0.60, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;phosphane is sourced from PubChem (CID 173071517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).