About 1,7-dihydro-1,7-naphthyridine
1,7-dihydro-1,7-naphthyridine (PubChem CID 173071795) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 1,7-dihydro-1,7-naphthyridine.
Molecular Properties
| Compound Name | 1,7-dihydro-1,7-naphthyridine |
| PubChem CID | 173071795 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 1,7-dihydro-1,7-naphthyridine |
| SMILES | C1=CNC2=CNC=CC2=C1 |
| InChI | InChI=1S/C8H8N2/c1-2-7-3-5-9-6-8(7)10-4-1/h1-6,9-10H |
| InChIKey | HXBJLHVDSBQXOL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,7-dihydro-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dihydro-1,7-naphthyridine?
The IUPAC name of 1,7-dihydro-1,7-naphthyridine (CID 173071795) is 1,7-dihydro-1,7-naphthyridine.
What is the SMILES notation for 1,7-dihydro-1,7-naphthyridine?
The canonical SMILES for 1,7-dihydro-1,7-naphthyridine is C1=CNC2=CNC=CC2=C1.
What is the InChIKey of 1,7-dihydro-1,7-naphthyridine?
The InChIKey is HXBJLHVDSBQXOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-2-7-3-5-9-6-8(7)10-4-1/h1-6,9-10H.
What are the key properties of 1,7-dihydro-1,7-naphthyridine?
1,7-dihydro-1,7-naphthyridine has a molecular weight of 132.17 g/mol, XLogP of 0.99, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dihydro-1,7-naphthyridine is sourced from PubChem (CID 173071795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).