C8H10N2 — CID 173072010
3,7,8,8a-tetrahydro-1,7-naphthyridine (PubChem CID 173072010) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 3,7,8,8a-tetrahydro-1,7-naphthyridine.
| Compound Name | 3,7,8,8a-tetrahydro-1,7-naphthyridine |
|---|---|
| PubChem CID | 173072010 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 3,7,8,8a-tetrahydro-1,7-naphthyridine |
| SMILES | C1=CC2=CCC=NC2CN1 |
| InChI | InChI=1S/C8H10N2/c1-2-7-3-5-9-6-8(7)10-4-1/h2-5,8-9H,1,6H2 |
| InChIKey | KCSOWRSVEQCUQY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |