C8H13N2+ — CID 173072114
1,2,3,4,5,8-hexahydro-1,7-naphthyridin-7-ium (PubChem CID 173072114) has the molecular formula C8H13N2+ and a molecular weight of 137.21 g/mol. Its IUPAC name is 1,2,3,4,5,8-hexahydro-1,7-naphthyridin-7-ium.
| Compound Name | 1,2,3,4,5,8-hexahydro-1,7-naphthyridin-7-ium |
|---|---|
| PubChem CID | 173072114 |
| Molecular Formula | C8H13N2+ |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.11 |
| IUPAC Name | 1,2,3,4,5,8-hexahydro-1,7-naphthyridin-7-ium |
| SMILES | C1=[NH+]CC2=C(C1)CCCN2 |
| InChI | InChI=1S/C8H12N2/c1-2-7-3-5-9-6-8(7)10-4-1/h5,10H,1-4,6H2/p+1 |
| InChIKey | BADMGAZDBBVCTL-UHFFFAOYSA-O |
| XLogP | -0.82 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |