C9H12N+ — CID 173072117
2,4a,5,6-tetrahydroquinolin-1-ium (PubChem CID 173072117) has the molecular formula C9H12N+ and a molecular weight of 134.20 g/mol. Its IUPAC name is 2,4a,5,6-tetrahydroquinolin-1-ium.
| Compound Name | 2,4a,5,6-tetrahydroquinolin-1-ium |
|---|---|
| PubChem CID | 173072117 |
| Molecular Formula | C9H12N+ |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.10 |
| IUPAC Name | 2,4a,5,6-tetrahydroquinolin-1-ium |
| SMILES | C1=CC2=[NH+]CC=CC2CC1 |
| InChI | InChI=1S/C9H11N/c1-2-6-9-8(4-1)5-3-7-10-9/h2-3,5-6,8H,1,4,7H2/p+1 |
| InChIKey | UKHCALIWQJXDBN-UHFFFAOYSA-O |
| XLogP | 0.04 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|