C8H13N2+ — CID 173072128
2,3,4,6,7,8-hexahydro-1,7-naphthyridin-1-ium (PubChem CID 173072128) has the molecular formula C8H13N2+ and a molecular weight of 137.21 g/mol. Its IUPAC name is 2,3,4,6,7,8-hexahydro-1,7-naphthyridin-1-ium.
| Compound Name | 2,3,4,6,7,8-hexahydro-1,7-naphthyridin-1-ium |
|---|---|
| PubChem CID | 173072128 |
| Molecular Formula | C8H13N2+ |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.11 |
| IUPAC Name | 2,3,4,6,7,8-hexahydro-1,7-naphthyridin-1-ium |
| SMILES | C1=C2CCC[NH+]=C2CNC1 |
| InChI | InChI=1S/C8H12N2/c1-2-7-3-5-9-6-8(7)10-4-1/h3,9H,1-2,4-6H2/p+1 |
| InChIKey | QUIIWEMYPPYPKJ-UHFFFAOYSA-O |
| XLogP | -1.17 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |