C8H10N2 — CID 173072201
1,2,5,8-tetrahydroquinazoline (PubChem CID 173072201) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 1,2,5,8-tetrahydroquinazoline.
| Compound Name | 1,2,5,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 173072201 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 1,2,5,8-tetrahydroquinazoline |
| SMILES | C1=CCC2=C(C=NCN2)C1 |
| InChI | InChI=1S/C8H10N2/c1-2-4-8-7(3-1)5-9-6-10-8/h1-2,5,10H,3-4,6H2 |
| InChIKey | DRKPSIKPIUXHBH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|