C8H11N2+ — CID 173072295
1,4,8,8a-tetrahydro-1,6-naphthyridin-6-ium (PubChem CID 173072295) has the molecular formula C8H11N2+ and a molecular weight of 135.19 g/mol. Its IUPAC name is 1,4,8,8a-tetrahydro-1,6-naphthyridin-6-ium.
| Compound Name | 1,4,8,8a-tetrahydro-1,6-naphthyridin-6-ium |
|---|---|
| PubChem CID | 173072295 |
| Molecular Formula | C8H11N2+ |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 1,4,8,8a-tetrahydro-1,6-naphthyridin-6-ium |
| SMILES | C1=CNC2CC=[NH+]C=C2C1 |
| InChI | InChI=1S/C8H10N2/c1-2-7-6-9-5-3-8(7)10-4-1/h1,4-6,8,10H,2-3H2/p+1 |
| InChIKey | UWEIRBMHBVOOIU-UHFFFAOYSA-O |
| XLogP | -0.70 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |