About 5,6-dihydrocinnolin-2-ium
5,6-dihydrocinnolin-2-ium (PubChem CID 173072305) has the molecular formula C8H9N2+
and a molecular weight of 133.17 g/mol. Its IUPAC name is 5,6-dihydrocinnolin-2-ium.
Molecular Properties
| Compound Name | 5,6-dihydrocinnolin-2-ium |
| PubChem CID | 173072305 |
| Molecular Formula | C8H9N2+ |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.08 |
| IUPAC Name | 5,6-dihydrocinnolin-2-ium |
| SMILES | C1=Cc2n[nH+]ccc2CC1 |
| InChI | InChI=1S/C8H8N2/c1-2-4-8-7(3-1)5-6-9-10-8/h2,4-6H,1,3H2/p+1 |
| InChIKey | PTCOOODESHWMQX-UHFFFAOYSA-O |
| XLogP | 0.86 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-dihydrocinnolin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydrocinnolin-2-ium?
The IUPAC name of 5,6-dihydrocinnolin-2-ium (CID 173072305) is 5,6-dihydrocinnolin-2-ium.
What is the SMILES notation for 5,6-dihydrocinnolin-2-ium?
The canonical SMILES for 5,6-dihydrocinnolin-2-ium is C1=Cc2n[nH+]ccc2CC1.
What is the InChIKey of 5,6-dihydrocinnolin-2-ium?
The InChIKey is PTCOOODESHWMQX-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H8N2/c1-2-4-8-7(3-1)5-6-9-10-8/h2,4-6H,1,3H2/p+1.
What are the key properties of 5,6-dihydrocinnolin-2-ium?
5,6-dihydrocinnolin-2-ium has a molecular weight of 133.17 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydrocinnolin-2-ium is sourced from PubChem (CID 173072305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).