C18H40N2Si — CID 173072586
(E)-4-methyl-2-N,2-N,2-N',2-N'-tetrapropyl-5-silylpent-4-ene-2,2-diamine (PubChem CID 173072586) has the molecular formula C18H40N2Si and a molecular weight of 312.62 g/mol. Its IUPAC name is (E)-4-methyl-2-N,2-N,2-N',2-N'-tetrapropyl-5-silylpent-4-ene-2,2-diamine.
| Compound Name | (E)-4-methyl-2-N,2-N,2-N',2-N'-tetrapropyl-5-silylpent-4-ene-2,2-diamine |
|---|---|
| PubChem CID | 173072586 |
| Molecular Formula | C18H40N2Si |
| Molecular Weight | 312.62 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | (E)-4-methyl-2-N,2-N,2-N',2-N'-tetrapropyl-5-silylpent-4-ene-2,2-diamine |
| SMILES | CCCN(CCC)C(C)(C/C(C)=C/[SiH3])N(CCC)CCC |
| InChI | InChI=1S/C18H40N2Si/c1-7-11-19(12-8-2)18(6,15-17(5)16-21)20(13-9-3)14-10-4/h16H,7-15H2,1-6,21H3/b17-16+ |
| InChIKey | MCRIYPXVAXEXNE-WUKNDPDISA-N |
| XLogP | 3.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|