About azane;1-octadecan-9-ylpyridin-1-ium;chloride
azane;1-octadecan-9-ylpyridin-1-ium;chloride (PubChem CID 173073424) has the molecular formula C23H45ClN2
and a molecular weight of 385.08 g/mol. Its IUPAC name is azane;1-octadecan-9-ylpyridin-1-ium;chloride.
Molecular Properties
| Compound Name | azane;1-octadecan-9-ylpyridin-1-ium;chloride |
| PubChem CID | 173073424 |
| Molecular Formula | C23H45ClN2 |
| Molecular Weight | 385.08 g/mol |
| Exact Mass | 384.33 |
| IUPAC Name | azane;1-octadecan-9-ylpyridin-1-ium;chloride |
| SMILES | CCCCCCCCCC(CCCCCCCC)[n+]1ccccc1.N.[Cl-] |
| InChI | InChI=1S/C23H42N.ClH.H3N/c1-3-5-7-9-11-13-16-20-23(24-21-17-14-18-22-24)19-15-12-10-8-6-4-2;;/h14,17-18,21-23H,3-13,15-16,19-20H2,1-2H3;1H;1H3/q+1;;/p-1 |
| InChIKey | JLWYVHKJFONVAG-UHFFFAOYSA-M |
| XLogP | 4.57 |
| TPSA | 38.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.08 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze azane;1-octadecan-9-ylpyridin-1-ium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-octadecan-9-ylpyridin-1-ium;chloride?
The IUPAC name of azane;1-octadecan-9-ylpyridin-1-ium;chloride (CID 173073424) is azane;1-octadecan-9-ylpyridin-1-ium;chloride.
What is the SMILES notation for azane;1-octadecan-9-ylpyridin-1-ium;chloride?
The canonical SMILES for azane;1-octadecan-9-ylpyridin-1-ium;chloride is CCCCCCCCCC(CCCCCCCC)[n+]1ccccc1.N.[Cl-].
What is the InChIKey of azane;1-octadecan-9-ylpyridin-1-ium;chloride?
The InChIKey is JLWYVHKJFONVAG-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H42N.ClH.H3N/c1-3-5-7-9-11-13-16-20-23(24-21-17-14-18-22-24)19-15-12-10-8-6-4-2;;/h14,17-18,21-23H,3-13,15-16,19-20H2,1-2H3;1H;1H3/q+1;;/p-1.
What are the key properties of azane;1-octadecan-9-ylpyridin-1-ium;chloride?
azane;1-octadecan-9-ylpyridin-1-ium;chloride has a molecular weight of 385.08 g/mol, XLogP of 4.57, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-octadecan-9-ylpyridin-1-ium;chloride is sourced from PubChem (CID 173073424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).