C35H49N3 — CID 173075150
1,3-bis[2,6-di(propan-2-yl)phenyl]-4-(2,4,6-trimethylphenyl)triazolidine (PubChem CID 173075150) has the molecular formula C35H49N3 and a molecular weight of 511.80 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-4-(2,4,6-trimethylphenyl)triazolidine.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-4-(2,4,6-trimethylphenyl)triazolidine |
|---|---|
| PubChem CID | 173075150 |
| Molecular Formula | C35H49N3 |
| Molecular Weight | 511.80 g/mol |
| Exact Mass | 511.39 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-4-(2,4,6-trimethylphenyl)triazolidine |
| SMILES | Cc1cc(C)c(C2CN(c3c(C(C)C)cccc3C(C)C)NN2c2c(C(C)C)cccc2C(C)C)c(C)c1 |
| InChI | InChI=1S/C35H49N3/c1-21(2)28-14-12-15-29(22(3)4)34(28)37-20-32(33-26(10)18-25(9)19-27(33)11)38(36-37)35-30(23(5)6)16-13-17-31(35)24(7)8/h12-19,21-24,32,36H,20H2,1-11H3 |
| InChIKey | AACZSTKUKZABPD-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.80 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |