About 5-iminocyclohexa-2,6-diene-1,2,4-triamine
5-iminocyclohexa-2,6-diene-1,2,4-triamine (PubChem CID 173075302) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 5-iminocyclohexa-2,6-diene-1,2,4-triamine.
Molecular Properties
| Compound Name | 5-iminocyclohexa-2,6-diene-1,2,4-triamine |
| PubChem CID | 173075302 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 5-iminocyclohexa-2,6-diene-1,2,4-triamine |
| SMILES | [H]/N=C1\C=C(N)C(N)=CC1N |
| InChI | InChI=1S/C6H10N4/c7-3-1-4(8)6(10)2-5(3)9/h1-3,9H,7-8,10H2/b9-5+ |
| InChIKey | KWZKZYADIULOMF-WEVVVXLNSA-N |
| XLogP | -0.97 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-iminocyclohexa-2,6-diene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iminocyclohexa-2,6-diene-1,2,4-triamine?
The IUPAC name of 5-iminocyclohexa-2,6-diene-1,2,4-triamine (CID 173075302) is 5-iminocyclohexa-2,6-diene-1,2,4-triamine.
What is the SMILES notation for 5-iminocyclohexa-2,6-diene-1,2,4-triamine?
The canonical SMILES for 5-iminocyclohexa-2,6-diene-1,2,4-triamine is [H]/N=C1\C=C(N)C(N)=CC1N.
What is the InChIKey of 5-iminocyclohexa-2,6-diene-1,2,4-triamine?
The InChIKey is KWZKZYADIULOMF-WEVVVXLNSA-N. The full InChI is InChI=1S/C6H10N4/c7-3-1-4(8)6(10)2-5(3)9/h1-3,9H,7-8,10H2/b9-5+.
What are the key properties of 5-iminocyclohexa-2,6-diene-1,2,4-triamine?
5-iminocyclohexa-2,6-diene-1,2,4-triamine has a molecular weight of 138.17 g/mol, XLogP of -0.97, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iminocyclohexa-2,6-diene-1,2,4-triamine is sourced from PubChem (CID 173075302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).