About benzyl sulfate;hydron
benzyl sulfate;hydron (PubChem CID 173075422) has the molecular formula C7H8O4S
and a molecular weight of 188.20 g/mol. Its IUPAC name is benzyl sulfate;hydron.
Molecular Properties
| Compound Name | benzyl sulfate;hydron |
| PubChem CID | 173075422 |
| Molecular Formula | C7H8O4S |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | benzyl sulfate;hydron |
| SMILES | O=S(=O)([O-])OCc1ccccc1.[H+] |
| InChI | InChI=1S/C7H8O4S/c8-12(9,10)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,8,9,10) |
| InChIKey | CZNJCCVKDVCRKF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze benzyl sulfate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl sulfate;hydron?
The IUPAC name of benzyl sulfate;hydron (CID 173075422) is benzyl sulfate;hydron.
What is the SMILES notation for benzyl sulfate;hydron?
The canonical SMILES for benzyl sulfate;hydron is O=S(=O)([O-])OCc1ccccc1.[H+].
What is the InChIKey of benzyl sulfate;hydron?
The InChIKey is CZNJCCVKDVCRKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4S/c8-12(9,10)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,8,9,10).
What are the key properties of benzyl sulfate;hydron?
benzyl sulfate;hydron has a molecular weight of 188.20 g/mol, XLogP of 0.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl sulfate;hydron is sourced from PubChem (CID 173075422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).