About propan-2-yl N-(1,3-dioxolan-4-yl)carbamate
propan-2-yl N-(1,3-dioxolan-4-yl)carbamate (PubChem CID 173075539) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is propan-2-yl N-(1,3-dioxolan-4-yl)carbamate.
Molecular Properties
| Compound Name | propan-2-yl N-(1,3-dioxolan-4-yl)carbamate |
| PubChem CID | 173075539 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | propan-2-yl N-(1,3-dioxolan-4-yl)carbamate |
| SMILES | CC(C)OC(=O)NC1COCO1 |
| InChI | InChI=1S/C7H13NO4/c1-5(2)12-7(9)8-6-3-10-4-11-6/h5-6H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | ZAEFIFDXANVLMP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl N-(1,3-dioxolan-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-(1,3-dioxolan-4-yl)carbamate?
The IUPAC name of propan-2-yl N-(1,3-dioxolan-4-yl)carbamate (CID 173075539) is propan-2-yl N-(1,3-dioxolan-4-yl)carbamate.
What is the SMILES notation for propan-2-yl N-(1,3-dioxolan-4-yl)carbamate?
The canonical SMILES for propan-2-yl N-(1,3-dioxolan-4-yl)carbamate is CC(C)OC(=O)NC1COCO1.
What is the InChIKey of propan-2-yl N-(1,3-dioxolan-4-yl)carbamate?
The InChIKey is ZAEFIFDXANVLMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c1-5(2)12-7(9)8-6-3-10-4-11-6/h5-6H,3-4H2,1-2H3,(H,8,9).
What are the key properties of propan-2-yl N-(1,3-dioxolan-4-yl)carbamate?
propan-2-yl N-(1,3-dioxolan-4-yl)carbamate has a molecular weight of 175.18 g/mol, XLogP of 0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-(1,3-dioxolan-4-yl)carbamate is sourced from PubChem (CID 173075539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).